C10H12N2O5 — CID 60832834
2-(1H-pyrrole-2-carbonylamino)pentanedioic acid (PubChem CID 60832834) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-(1H-pyrrole-2-carbonylamino)pentanedioic acid.
| Compound Name | 2-(1H-pyrrole-2-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 60832834 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(1H-pyrrole-2-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc[nH]1)C(=O)O |
| InChI | InChI=1S/C10H12N2O5/c13-8(14)4-3-7(10(16)17)12-9(15)6-2-1-5-11-6/h1-2,5,7,11H,3-4H2,(H,12,15)(H,13,14)(H,16,17) |
| InChIKey | QIOYPPJFWNBPJT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |