C10H10Cl2N2O5 — CID 54926923
2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]pentanedioic acid (PubChem CID 54926923) has the molecular formula C10H10Cl2N2O5 and a molecular weight of 309.11 g/mol. Its IUPAC name is 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 54926923 |
| Molecular Formula | C10H10Cl2N2O5 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1cc(Cl)c(Cl)[nH]1)C(=O)O |
| InChI | InChI=1S/C10H10Cl2N2O5/c11-4-3-6(13-8(4)12)9(17)14-5(10(18)19)1-2-7(15)16/h3,5,13H,1-2H2,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | QEUKFELDPKXQDN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |