C11H12Cl2N2O5 — CID 60831652
2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]pentanedioic acid (PubChem CID 60831652) has the molecular formula C11H12Cl2N2O5 and a molecular weight of 323.13 g/mol. Its IUPAC name is 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 60831652 |
| Molecular Formula | C11H12Cl2N2O5 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]pentanedioic acid |
| SMILES | Cn1c(C(=O)NC(CCC(=O)O)C(=O)O)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O5/c1-15-7(4-5(12)9(15)13)10(18)14-6(11(19)20)2-3-8(16)17/h4,6H,2-3H2,1H3,(H,14,18)(H,16,17)(H,19,20) |
| InChIKey | UEVBJEWRJAUIAW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |