C10H12Cl2N2O3S — CID 114212558
2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-4-sulfanylbutanoic acid (PubChem CID 114212558) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 114212558 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2-[(4,5-dichloro-1-methylpyrrole-2-carbonyl)amino]-4-sulfanylbutanoic acid |
| SMILES | Cn1c(C(=O)NC(CCS)C(=O)O)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2N2O3S/c1-14-7(4-5(11)8(14)12)9(15)13-6(2-3-18)10(16)17/h4,6,18H,2-3H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | IKGVHIRBBSLECT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|