C12H15ClN2O5 — CID 107820326
(2S)-2-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820326) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820326 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2S)-2-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1cc(Cl)cn1C)C(=O)O |
| InChI | InChI=1S/C12H15ClN2O5/c1-15-6-7(13)5-9(15)11(17)14-8(12(18)19)3-4-10(16)20-2/h5-6,8H,3-4H2,1-2H3,(H,14,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | OCQPGDOQCPWZFG-QMMMGPOBSA-N |
| XLogP | 0.81 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |