C15H14N2O6 — CID 151134503
(2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]pentanedioic acid (PubChem CID 151134503) has the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. Its IUPAC name is (2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 151134503 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cc(=O)c2ccccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C15H14N2O6/c18-12-7-11(16-9-4-2-1-3-8(9)12)14(21)17-10(15(22)23)5-6-13(19)20/h1-4,7,10H,5-6H2,(H,16,18)(H,17,21)(H,19,20)(H,22,23)/t10-/m0/s1 |
| InChIKey | MUXUEPBRUULNMY-JTQLQIEISA-N |
| XLogP | 0.58 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |