C14H14N2O5 — CID 61244394
4-hydroxy-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]butanoic acid (PubChem CID 61244394) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-hydroxy-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]butanoic acid.
| Compound Name | 4-hydroxy-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 61244394 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-hydroxy-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(NC(CCO)C(=O)O)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C14H14N2O5/c17-6-5-10(14(20)21)16-13(19)11-7-12(18)8-3-1-2-4-9(8)15-11/h1-4,7,10,17H,5-6H2,(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | NIICZPDESKGGPF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |