C26H28N4O6 — CID 141217874
4-[(2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylic acid (PubChem CID 141217874) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-[(2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141217874 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-[(2S)-2-[(4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylic acid |
| SMILES | O=C(N[C@@H](CCOCc1ccccc1)C(=O)N1CCN(C(=O)O)CC1)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C26H28N4O6/c31-23-16-22(27-20-9-5-4-8-19(20)23)24(32)28-21(10-15-36-17-18-6-2-1-3-7-18)25(33)29-11-13-30(14-12-29)26(34)35/h1-9,16,21H,10-15,17H2,(H,27,31)(H,28,32)(H,34,35)/t21-/m0/s1 |
| InChIKey | SNJSRMBSGABTPE-NRFANRHFSA-N |
| XLogP | 2.06 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|