C31H38N4O6 — CID 68601993
butyl 4-[(2S)-2-[(7-methyl-4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylate (PubChem CID 68601993) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is butyl 4-[(2S)-2-[(7-methyl-4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2S)-2-[(7-methyl-4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68601993 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | butyl 4-[(2S)-2-[(7-methyl-4-oxo-1H-quinoline-2-carbonyl)amino]-4-phenylmethoxybutanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](CCOCc2ccccc2)NC(=O)c2cc(=O)c3ccc(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/C31H38N4O6/c1-3-4-17-41-31(39)35-15-13-34(14-16-35)30(38)25(12-18-40-21-23-8-6-5-7-9-23)33-29(37)27-20-28(36)24-11-10-22(2)19-26(24)32-27/h5-11,19-20,25H,3-4,12-18,21H2,1-2H3,(H,32,36)(H,33,37)/t25-/m0/s1 |
| InChIKey | LHPQAYYWGPULQO-VWLOTQADSA-N |
| XLogP | 3.62 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|