C21H32N3O8P — CID 87200286
butyl 4-[2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetyl]piperazine-1-carboxylate (PubChem CID 87200286) has the molecular formula C21H32N3O8P and a molecular weight of 485.47 g/mol. Its IUPAC name is butyl 4-[2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87200286 |
| Molecular Formula | C21H32N3O8P |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | butyl 4-[2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C(NC(=O)OCc2ccccc2)P(=O)(OC)OC)CC1 |
| InChI | InChI=1S/C21H32N3O8P/c1-4-5-15-31-21(27)24-13-11-23(12-14-24)19(25)18(33(28,29-2)30-3)22-20(26)32-16-17-9-7-6-8-10-17/h6-10,18H,4-5,11-16H2,1-3H3,(H,22,26) |
| InChIKey | LYHPSPBNZMBVQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|