C13H13NO6 — CID 11529227
(2S)-2-[(2-formylbenzoyl)amino]pentanedioic acid (PubChem CID 11529227) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is (2S)-2-[(2-formylbenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-formylbenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 11529227 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2S)-2-[(2-formylbenzoyl)amino]pentanedioic acid |
| SMILES | O=Cc1ccccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H13NO6/c15-7-8-3-1-2-4-9(8)12(18)14-10(13(19)20)5-6-11(16)17/h1-4,7,10H,5-6H2,(H,14,18)(H,16,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | CLLCZMANKXGPAI-JTQLQIEISA-N |
| XLogP | 0.55 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|