C17H23NO6 — CID 143020846
dimethyl 2-[(2-formylbenzoyl)amino]pentanedioate;ethane (PubChem CID 143020846) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is dimethyl 2-[(2-formylbenzoyl)amino]pentanedioate;ethane.
| Compound Name | dimethyl 2-[(2-formylbenzoyl)amino]pentanedioate;ethane |
|---|---|
| PubChem CID | 143020846 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | dimethyl 2-[(2-formylbenzoyl)amino]pentanedioate;ethane |
| SMILES | CC.COC(=O)CCC(NC(=O)c1ccccc1C=O)C(=O)OC |
| InChI | InChI=1S/C15H17NO6.C2H6/c1-21-13(18)8-7-12(15(20)22-2)16-14(19)11-6-4-3-5-10(11)9-17;1-2/h3-6,9,12H,7-8H2,1-2H3,(H,16,19);1-2H3 |
| InChIKey | VUCBOEMQBKBCHA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|