2-[(2,5-dibromobenzoyl)amino]pentanedioic acid

C12H11Br2NO5 — CID 114367907

IUPAC2-[(2,5-dibromobenzoyl)amino]pentanedioic acid
SMILESO=C(O)CCC(NC(=O)c1cc(Br)ccc1Br)C(=O)O
InChIInChI=1S/C12H11Br2NO5/c13-6-1-2-8(14)7(5-6)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4H2,(H,15,18)(H,16,17)(H,19,20)
InChIKeySNNQXEGVAYEXMB-UHFFFAOYSA-N
MW409.03 g/mol
LogP2.26
Rot. Bonds6

About 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid

2-[(2,5-dibromobenzoyl)amino]pentanedioic acid (PubChem CID 114367907) has the molecular formula C12H11Br2NO5 and a molecular weight of 409.03 g/mol. Its IUPAC name is 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid.

Molecular Properties

Compound Name2-[(2,5-dibromobenzoyl)amino]pentanedioic acid
PubChem CID114367907
Molecular FormulaC12H11Br2NO5
Molecular Weight409.03 g/mol
Exact Mass406.90
IUPAC Name2-[(2,5-dibromobenzoyl)amino]pentanedioic acid
SMILESO=C(O)CCC(NC(=O)c1cc(Br)ccc1Br)C(=O)O
InChIInChI=1S/C12H11Br2NO5/c13-6-1-2-8(14)7(5-6)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4H2,(H,15,18)(H,16,17)(H,19,20)
InChIKeySNNQXEGVAYEXMB-UHFFFAOYSA-N
XLogP2.26
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500409.03
LogP ≤ 52.26
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid?
The IUPAC name of 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid (CID 114367907) is 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid.
What is the SMILES notation for 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid?
The canonical SMILES for 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid is O=C(O)CCC(NC(=O)c1cc(Br)ccc1Br)C(=O)O.
What is the InChIKey of 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid?
The InChIKey is SNNQXEGVAYEXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Br2NO5/c13-6-1-2-8(14)7(5-6)11(18)15-9(12(19)20)3-4-10(16)17/h1-2,5,9H,3-4H2,(H,15,18)(H,16,17)(H,19,20).
What are the key properties of 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid?
2-[(2,5-dibromobenzoyl)amino]pentanedioic acid has a molecular weight of 409.03 g/mol, XLogP of 2.26, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dibromobenzoyl)amino]pentanedioic acid is sourced from PubChem (CID 114367907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).