C13H14BrNO5 — CID 81110365
2-[(2-bromo-5-methylbenzoyl)amino]pentanedioic acid (PubChem CID 81110365) has the molecular formula C13H14BrNO5 and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-[(2-bromo-5-methylbenzoyl)amino]pentanedioic acid.
| Compound Name | 2-[(2-bromo-5-methylbenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 81110365 |
| Molecular Formula | C13H14BrNO5 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-[(2-bromo-5-methylbenzoyl)amino]pentanedioic acid |
| SMILES | Cc1ccc(Br)c(C(=O)NC(CCC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C13H14BrNO5/c1-7-2-3-9(14)8(6-7)12(18)15-10(13(19)20)4-5-11(16)17/h2-3,6,10H,4-5H2,1H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | HEVWWEOHHHIQIT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |