C13H15BrN2O5 — CID 61182556
2-[(2-bromo-4-methylphenyl)carbamoylamino]pentanedioic acid (PubChem CID 61182556) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is 2-[(2-bromo-4-methylphenyl)carbamoylamino]pentanedioic acid.
| Compound Name | 2-[(2-bromo-4-methylphenyl)carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61182556 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-[(2-bromo-4-methylphenyl)carbamoylamino]pentanedioic acid |
| SMILES | Cc1ccc(NC(=O)NC(CCC(=O)O)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O5/c1-7-2-3-9(8(14)6-7)15-13(21)16-10(12(19)20)4-5-11(17)18/h2-3,6,10H,4-5H2,1H3,(H,17,18)(H,19,20)(H2,15,16,21) |
| InChIKey | JNUQKRRBFGKOKI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |