C24H23N3O6 — CID 58994736
(2S)-2-[[3-[(2-methylphenyl)carbamoylamino]naphthalene-2-carbonyl]amino]pentanedioic acid (PubChem CID 58994736) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is (2S)-2-[[3-[(2-methylphenyl)carbamoylamino]naphthalene-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[3-[(2-methylphenyl)carbamoylamino]naphthalene-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 58994736 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2S)-2-[[3-[(2-methylphenyl)carbamoylamino]naphthalene-2-carbonyl]amino]pentanedioic acid |
| SMILES | Cc1ccccc1NC(=O)Nc1cc2ccccc2cc1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H23N3O6/c1-14-6-2-5-9-18(14)26-24(33)27-20-13-16-8-4-3-7-15(16)12-17(20)22(30)25-19(23(31)32)10-11-21(28)29/h2-9,12-13,19H,10-11H2,1H3,(H,25,30)(H,28,29)(H,31,32)(H2,26,27,33)/t19-/m0/s1 |
| InChIKey | QWVFFHQWYYWECD-IBGZPJMESA-N |
| XLogP | 3.84 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |