C14H17ClN2O5 — CID 22996957
2-amino-2-[2-(2-chloroethylamino)benzoyl]pentanedioic acid (PubChem CID 22996957) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is 2-amino-2-[2-(2-chloroethylamino)benzoyl]pentanedioic acid.
| Compound Name | 2-amino-2-[2-(2-chloroethylamino)benzoyl]pentanedioic acid |
|---|---|
| PubChem CID | 22996957 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-amino-2-[2-(2-chloroethylamino)benzoyl]pentanedioic acid |
| SMILES | NC(CCC(=O)O)(C(=O)O)C(=O)c1ccccc1NCCCl |
| InChI | InChI=1S/C14H17ClN2O5/c15-7-8-17-10-4-2-1-3-9(10)12(20)14(16,13(21)22)6-5-11(18)19/h1-4,17H,5-8,16H2,(H,18,19)(H,21,22) |
| InChIKey | LFISGGRTERNEQO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|