C14H19N3O7 — CID 174960116
(2S)-5-amino-2-[[[carboxy(phenylmethoxy)methyl]amino]-hydroxyamino]-5-oxopentanoic acid (PubChem CID 174960116) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is (2S)-5-amino-2-[[[carboxy(phenylmethoxy)methyl]amino]-hydroxyamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[[carboxy(phenylmethoxy)methyl]amino]-hydroxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174960116 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2S)-5-amino-2-[[[carboxy(phenylmethoxy)methyl]amino]-hydroxyamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(O)NC(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19N3O7/c15-11(18)7-6-10(13(19)20)17(23)16-12(14(21)22)24-8-9-4-2-1-3-5-9/h1-5,10,12,16,23H,6-8H2,(H2,15,18)(H,19,20)(H,21,22)/t10-,12?/m0/s1 |
| InChIKey | FCUVDTWBWHSZGU-NUHJPDEHSA-N |
| XLogP | -0.47 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|