C12H16N2O6S — CID 150317196
(2S)-5-amino-5-oxo-2-[N-(sulfomethyl)anilino]pentanoic acid (PubChem CID 150317196) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[N-(sulfomethyl)anilino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[N-(sulfomethyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 150317196 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[N-(sulfomethyl)anilino]pentanoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(CS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O6S/c13-11(15)7-6-10(12(16)17)14(8-21(18,19)20)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,13,15)(H,16,17)(H,18,19,20)/t10-/m0/s1 |
| InChIKey | GMVXBHLJWPRYOM-JTQLQIEISA-N |
| XLogP | 0.06 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|