C12H16N2O6PdS — CID 174496056
[[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium (PubChem CID 174496056) has the molecular formula C12H16N2O6PdS and a molecular weight of 422.76 g/mol. Its IUPAC name is [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium.
| Compound Name | [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium |
|---|---|
| PubChem CID | 174496056 |
| Molecular Formula | C12H16N2O6PdS |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium |
| SMILES | NC(=O)CC[C@H](NCS(=O)(=O)O)C(=O)Oc1ccccc1.[Pd] |
| InChI | InChI=1S/C12H16N2O6S.Pd/c13-11(15)7-6-10(14-8-21(17,18)19)12(16)20-9-4-2-1-3-5-9;/h1-5,10,14H,6-8H2,(H2,13,15)(H,17,18,19);/t10-;/m0./s1 |
| InChIKey | CGZTZGXAJDTVIM-PPHPATTJSA-N |
| XLogP | -0.34 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|