About [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium
[[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium (PubChem CID 174496056) has the molecular formula C12H16N2O6PdS
and a molecular weight of 422.76 g/mol. Its IUPAC name is [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium.
Molecular Properties
| Compound Name | [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium |
| PubChem CID | 174496056 |
| Molecular Formula | C12H16N2O6PdS |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium |
| SMILES | NC(=O)CC[C@H](NCS(=O)(=O)O)C(=O)Oc1ccccc1.[Pd] |
| InChI | InChI=1S/C12H16N2O6S.Pd/c13-11(15)7-6-10(14-8-21(17,18)19)12(16)20-9-4-2-1-3-5-9;/h1-5,10,14H,6-8H2,(H2,13,15)(H,17,18,19);/t10-;/m0./s1 |
| InChIKey | CGZTZGXAJDTVIM-PPHPATTJSA-N |
| XLogP | -0.34 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium?
The IUPAC name of [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium (CID 174496056) is [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium.
What is the SMILES notation for [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium?
The canonical SMILES for [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium is NC(=O)CC[C@H](NCS(=O)(=O)O)C(=O)Oc1ccccc1.[Pd].
What is the InChIKey of [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium?
The InChIKey is CGZTZGXAJDTVIM-PPHPATTJSA-N. The full InChI is InChI=1S/C12H16N2O6S.Pd/c13-11(15)7-6-10(14-8-21(17,18)19)12(16)20-9-4-2-1-3-5-9;/h1-5,10,14H,6-8H2,(H2,13,15)(H,17,18,19);/t10-;/m0./s1.
What are the key properties of [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium?
[[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium has a molecular weight of 422.76 g/mol, XLogP of -0.34, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2S)-5-amino-1,5-dioxo-1-phenoxypentan-2-yl]amino]methanesulfonic acid;palladium is sourced from PubChem (CID 174496056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).