About phenyl 2-bromo-2-chloroacetate
phenyl 2-bromo-2-chloroacetate (PubChem CID 174609883) has the molecular formula C8H6BrClO2
and a molecular weight of 249.49 g/mol. Its IUPAC name is phenyl 2-bromo-2-chloroacetate.
Molecular Properties
| Compound Name | phenyl 2-bromo-2-chloroacetate |
| PubChem CID | 174609883 |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 247.92 |
| IUPAC Name | phenyl 2-bromo-2-chloroacetate |
| SMILES | O=C(Oc1ccccc1)C(Cl)Br |
| InChI | InChI=1S/C8H6BrClO2/c9-7(10)8(11)12-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | YDKCCLGQQLVAHI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-bromo-2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-bromo-2-chloroacetate?
The IUPAC name of phenyl 2-bromo-2-chloroacetate (CID 174609883) is phenyl 2-bromo-2-chloroacetate.
What is the SMILES notation for phenyl 2-bromo-2-chloroacetate?
The canonical SMILES for phenyl 2-bromo-2-chloroacetate is O=C(Oc1ccccc1)C(Cl)Br.
What is the InChIKey of phenyl 2-bromo-2-chloroacetate?
The InChIKey is YDKCCLGQQLVAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrClO2/c9-7(10)8(11)12-6-4-2-1-3-5-6/h1-5,7H.
What are the key properties of phenyl 2-bromo-2-chloroacetate?
phenyl 2-bromo-2-chloroacetate has a molecular weight of 249.49 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-bromo-2-chloroacetate is sourced from PubChem (CID 174609883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).