About (4-chlorophenyl) 2-chloro-2-phenylacetate
(4-chlorophenyl) 2-chloro-2-phenylacetate (PubChem CID 139902488) has the molecular formula C14H10Cl2O2
and a molecular weight of 281.14 g/mol. Its IUPAC name is (4-chlorophenyl) 2-chloro-2-phenylacetate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-chloro-2-phenylacetate |
| PubChem CID | 139902488 |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (4-chlorophenyl) 2-chloro-2-phenylacetate |
| SMILES | O=C(Oc1ccc(Cl)cc1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2O2/c15-11-6-8-12(9-7-11)18-14(17)13(16)10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | YRTOOVIOMZHHGB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-chloro-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-chloro-2-phenylacetate?
The IUPAC name of (4-chlorophenyl) 2-chloro-2-phenylacetate (CID 139902488) is (4-chlorophenyl) 2-chloro-2-phenylacetate.
What is the SMILES notation for (4-chlorophenyl) 2-chloro-2-phenylacetate?
The canonical SMILES for (4-chlorophenyl) 2-chloro-2-phenylacetate is O=C(Oc1ccc(Cl)cc1)C(Cl)c1ccccc1.
What is the InChIKey of (4-chlorophenyl) 2-chloro-2-phenylacetate?
The InChIKey is YRTOOVIOMZHHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O2/c15-11-6-8-12(9-7-11)18-14(17)13(16)10-4-2-1-3-5-10/h1-9,13H.
What are the key properties of (4-chlorophenyl) 2-chloro-2-phenylacetate?
(4-chlorophenyl) 2-chloro-2-phenylacetate has a molecular weight of 281.14 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-chloro-2-phenylacetate is sourced from PubChem (CID 139902488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).