C9H9ClO4 — CID 23616443
(4-chlorophenyl) 2,3-dihydroxypropanoate (PubChem CID 23616443) has the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. Its IUPAC name is (4-chlorophenyl) 2,3-dihydroxypropanoate.
| Compound Name | (4-chlorophenyl) 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 23616443 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (4-chlorophenyl) 2,3-dihydroxypropanoate |
| SMILES | O=C(Oc1ccc(Cl)cc1)C(O)CO |
| InChI | InChI=1S/C9H9ClO4/c10-6-1-3-7(4-2-6)14-9(13)8(12)5-11/h1-4,8,11-12H,5H2 |
| InChIKey | WPLPDEYBFXXPSY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|