About (4-chlorophenoxy)methyl propanoate
(4-chlorophenoxy)methyl propanoate (PubChem CID 174802053) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is (4-chlorophenoxy)methyl propanoate.
Molecular Properties
| Compound Name | (4-chlorophenoxy)methyl propanoate |
| PubChem CID | 174802053 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (4-chlorophenoxy)methyl propanoate |
| SMILES | CCC(=O)OCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClO3/c1-2-10(12)14-7-13-9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3 |
| InChIKey | CSPLHGZBADYRKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenoxy)methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenoxy)methyl propanoate?
The IUPAC name of (4-chlorophenoxy)methyl propanoate (CID 174802053) is (4-chlorophenoxy)methyl propanoate.
What is the SMILES notation for (4-chlorophenoxy)methyl propanoate?
The canonical SMILES for (4-chlorophenoxy)methyl propanoate is CCC(=O)OCOc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenoxy)methyl propanoate?
The InChIKey is CSPLHGZBADYRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-2-10(12)14-7-13-9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3.
What are the key properties of (4-chlorophenoxy)methyl propanoate?
(4-chlorophenoxy)methyl propanoate has a molecular weight of 214.65 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenoxy)methyl propanoate is sourced from PubChem (CID 174802053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).