About (4-chlorophenyl) 2-hydroxyethyl carbonate
(4-chlorophenyl) 2-hydroxyethyl carbonate (PubChem CID 54130253) has the molecular formula C9H9ClO4
and a molecular weight of 216.62 g/mol. Its IUPAC name is (4-chlorophenyl) 2-hydroxyethyl carbonate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-hydroxyethyl carbonate |
| PubChem CID | 54130253 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (4-chlorophenyl) 2-hydroxyethyl carbonate |
| SMILES | O=C(OCCO)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO4/c10-7-1-3-8(4-2-7)14-9(12)13-6-5-11/h1-4,11H,5-6H2 |
| InChIKey | HJHQSDCLEZSCKL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-hydroxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-hydroxyethyl carbonate?
The IUPAC name of (4-chlorophenyl) 2-hydroxyethyl carbonate (CID 54130253) is (4-chlorophenyl) 2-hydroxyethyl carbonate.
What is the SMILES notation for (4-chlorophenyl) 2-hydroxyethyl carbonate?
The canonical SMILES for (4-chlorophenyl) 2-hydroxyethyl carbonate is O=C(OCCO)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) 2-hydroxyethyl carbonate?
The InChIKey is HJHQSDCLEZSCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO4/c10-7-1-3-8(4-2-7)14-9(12)13-6-5-11/h1-4,11H,5-6H2.
What are the key properties of (4-chlorophenyl) 2-hydroxyethyl carbonate?
(4-chlorophenyl) 2-hydroxyethyl carbonate has a molecular weight of 216.62 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-hydroxyethyl carbonate is sourced from PubChem (CID 54130253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).