C9H13ClO5S — CID 71365177
2-(4-chlorophenoxy)ethanol;methanesulfonic acid (PubChem CID 71365177) has the molecular formula C9H13ClO5S and a molecular weight of 268.72 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethanol;methanesulfonic acid.
| Compound Name | 2-(4-chlorophenoxy)ethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 71365177 |
| Molecular Formula | C9H13ClO5S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-(4-chlorophenoxy)ethanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H9ClO2.CH4O3S/c9-7-1-3-8(4-2-7)11-6-5-10;1-5(2,3)4/h1-4,10H,5-6H2;1H3,(H,2,3,4) |
| InChIKey | LZVWUDLUOIXPEN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|