About 2-(4-methylphenoxy)ethanol;thionyl dichloride
2-(4-methylphenoxy)ethanol;thionyl dichloride (PubChem CID 91035331) has the molecular formula C9H12Cl2O3S
and a molecular weight of 271.17 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethanol;thionyl dichloride.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)ethanol;thionyl dichloride |
| PubChem CID | 91035331 |
| Molecular Formula | C9H12Cl2O3S |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 2-(4-methylphenoxy)ethanol;thionyl dichloride |
| SMILES | Cc1ccc(OCCO)cc1.O=S(Cl)Cl |
| InChI | InChI=1S/C9H12O2.Cl2OS/c1-8-2-4-9(5-3-8)11-7-6-10;1-4(2)3/h2-5,10H,6-7H2,1H3; |
| InChIKey | GGFNOWROXVOZNY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenoxy)ethanol;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)ethanol;thionyl dichloride?
The IUPAC name of 2-(4-methylphenoxy)ethanol;thionyl dichloride (CID 91035331) is 2-(4-methylphenoxy)ethanol;thionyl dichloride.
What is the SMILES notation for 2-(4-methylphenoxy)ethanol;thionyl dichloride?
The canonical SMILES for 2-(4-methylphenoxy)ethanol;thionyl dichloride is Cc1ccc(OCCO)cc1.O=S(Cl)Cl.
What is the InChIKey of 2-(4-methylphenoxy)ethanol;thionyl dichloride?
The InChIKey is GGFNOWROXVOZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.Cl2OS/c1-8-2-4-9(5-3-8)11-7-6-10;1-4(2)3/h2-5,10H,6-7H2,1H3;.
What are the key properties of 2-(4-methylphenoxy)ethanol;thionyl dichloride?
2-(4-methylphenoxy)ethanol;thionyl dichloride has a molecular weight of 271.17 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)ethanol;thionyl dichloride is sourced from PubChem (CID 91035331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).