About [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane
[4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane (PubChem CID 144982156) has the molecular formula C24H34ClNO5
and a molecular weight of 451.99 g/mol. Its IUPAC name is [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane.
Molecular Properties
| Compound Name | [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane |
| PubChem CID | 144982156 |
| Molecular Formula | C24H34ClNO5 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane |
| SMILES | CC.CCC.CN(CCO)CCOC(=O)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClNO5.C3H8.C2H6/c1-21(10-12-22)11-13-25-19(24)26-17-8-4-15(5-9-17)18(23)14-2-6-16(20)7-3-14;1-3-2;1-2/h2-9,22H,10-13H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | YBBRFIDTQIKMEP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane?
The IUPAC name of [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane (CID 144982156) is [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane.
What is the SMILES notation for [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane?
The canonical SMILES for [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane is CC.CCC.CN(CCO)CCOC(=O)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1.
What is the InChIKey of [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane?
The InChIKey is YBBRFIDTQIKMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClNO5.C3H8.C2H6/c1-21(10-12-22)11-13-25-19(24)26-17-8-4-15(5-9-17)18(23)14-2-6-16(20)7-3-14;1-3-2;1-2/h2-9,22H,10-13H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane?
[4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane has a molecular weight of 451.99 g/mol, XLogP of 5.45, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorobenzoyl)phenyl] 2-[2-hydroxyethyl(methyl)amino]ethyl carbonate;ethane;propane is sourced from PubChem (CID 144982156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).