About 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride
4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride (PubChem CID 21150232) has the molecular formula C13H21Cl2NO3
and a molecular weight of 310.22 g/mol. Its IUPAC name is 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride |
| PubChem CID | 21150232 |
| Molecular Formula | C13H21Cl2NO3 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride |
| SMILES | CCN(CC)CCO.Cl.O=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H5ClO2.C6H15NO.ClH/c8-6-3-1-5(2-4-6)7(9)10;1-3-7(4-2)5-6-8;/h1-4H,(H,9,10);8H,3-6H2,1-2H3;1H |
| InChIKey | YSVHKGRYSUJYBK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride?
The IUPAC name of 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride (CID 21150232) is 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride.
What is the SMILES notation for 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride?
The canonical SMILES for 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride is CCN(CC)CCO.Cl.O=C(O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride?
The InChIKey is YSVHKGRYSUJYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.C6H15NO.ClH/c8-6-3-1-5(2-4-6)7(9)10;1-3-7(4-2)5-6-8;/h1-4H,(H,9,10);8H,3-6H2,1-2H3;1H.
What are the key properties of 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride?
4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride has a molecular weight of 310.22 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzoic acid;2-(diethylamino)ethanol;hydrochloride is sourced from PubChem (CID 21150232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).