About 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid
4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid (PubChem CID 4020703) has the molecular formula C17H25ClN2O3
and a molecular weight of 340.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid |
| PubChem CID | 4020703 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid |
| SMILES | CCN(CC)CCCNC(CC(=O)C1=CC=C(C=C1)Cl)C(=O)O |
| InChI | InChI=1S/C17H25ClN2O3/c1-3-20(4-2)11-5-10-19-15(17(22)23)12-16(21)13-6-8-14(18)9-7-13/h6-9,15,19H,3-5,10-12H2,1-2H3,(H,22,23) |
| InChIKey | GJQSWTXXLJYDIR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | 367 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid?
The IUPAC name of 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid (CID 4020703) is 4-(4-chlorophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid?
The canonical SMILES for 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid is CCN(CC)CCCNC(CC(=O)C1=CC=C(C=C1)Cl)C(=O)O.
What is the InChIKey of 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid?
The InChIKey is GJQSWTXXLJYDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O3/c1-3-20(4-2)11-5-10-19-15(17(22)23)12-16(21)13-6-8-14(18)9-7-13/h6-9,15,19H,3-5,10-12H2,1-2H3,(H,22,23).
What are the key properties of 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid?
4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid has a molecular weight of 340.80 g/mol, XLogP of 0.20, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-Chlorophenyl)-2-{[3-(diethylamino)propyl]amino}-4-oxobutanoic acid is sourced from PubChem (CID 4020703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).