C16H24ClN3O3 — CID 7166042
(2R)-4-(4-chloroanilino)-2-[2-(diethylamino)ethylamino]-4-oxobutanoic acid (PubChem CID 7166042) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is (2R)-4-(4-chloroanilino)-2-[2-(diethylamino)ethylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-chloroanilino)-2-[2-(diethylamino)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7166042 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (2R)-4-(4-chloroanilino)-2-[2-(diethylamino)ethylamino]-4-oxobutanoic acid |
| SMILES | CCN(CC)CCN[C@H](CC(=O)Nc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H24ClN3O3/c1-3-20(4-2)10-9-18-14(16(22)23)11-15(21)19-13-7-5-12(17)6-8-13/h5-8,14,18H,3-4,9-11H2,1-2H3,(H,19,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | VFCICZRCXXDCFD-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |