C17H25BrN2O3 — CID 7104150
(2S)-4-(4-bromophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid (PubChem CID 7104150) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is (2S)-4-(4-bromophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-(4-bromophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7104150 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2S)-4-(4-bromophenyl)-2-[3-(diethylamino)propylamino]-4-oxobutanoic acid |
| SMILES | CCN(CC)CCCN[C@@H](CC(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C17H25BrN2O3/c1-3-20(4-2)11-5-10-19-15(17(22)23)12-16(21)13-6-8-14(18)9-7-13/h6-9,15,19H,3-5,10-12H2,1-2H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | MIIVPDZZUGXBEQ-HNNXBMFYSA-N |
| XLogP | 2.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|