C13H17BrN2O4 — CID 7422377
(2S)-4-(4-bromoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid (PubChem CID 7422377) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is (2S)-4-(4-bromoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-(4-bromoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7422377 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (2S)-4-(4-bromoanilino)-2-(3-hydroxypropylamino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](NCCCO)C(=O)O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrN2O4/c14-9-2-4-10(5-3-9)16-12(18)8-11(13(19)20)15-6-1-7-17/h2-5,11,15,17H,1,6-8H2,(H,16,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | JJUGRZRYHQKJLO-NSHDSACASA-N |
| XLogP | 1.20 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|