C13H16N2O6 — CID 27331834
4-[[(3R)-3-carboxy-3-(2-hydroxyethylamino)propanoyl]amino]benzoic acid (PubChem CID 27331834) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[[(3R)-3-carboxy-3-(2-hydroxyethylamino)propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(3R)-3-carboxy-3-(2-hydroxyethylamino)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 27331834 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[[(3R)-3-carboxy-3-(2-hydroxyethylamino)propanoyl]amino]benzoic acid |
| SMILES | O=C(C[C@@H](NCCO)C(=O)O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O6/c16-6-5-14-10(13(20)21)7-11(17)15-9-3-1-8(2-4-9)12(18)19/h1-4,10,14,16H,5-7H2,(H,15,17)(H,18,19)(H,20,21)/t10-/m1/s1 |
| InChIKey | NTCVUMHYBCEWFD-SNVBAGLBSA-N |
| XLogP | -0.25 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |