C11H10ClO3- — CID 7010070
(2S)-4-(4-chlorophenyl)-2-methyl-4-oxobutanoate (PubChem CID 7010070) has the molecular formula C11H10ClO3- and a molecular weight of 225.65 g/mol. Its IUPAC name is (2S)-4-(4-chlorophenyl)-2-methyl-4-oxobutanoate.
| Compound Name | (2S)-4-(4-chlorophenyl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 7010070 |
| Molecular Formula | C11H10ClO3- |
| Molecular Weight | 225.65 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (2S)-4-(4-chlorophenyl)-2-methyl-4-oxobutanoate |
| SMILES | C[C@@H](CC(=O)c1ccc(Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H11ClO3/c1-7(11(14)15)6-10(13)8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H,14,15)/p-1/t7-/m0/s1 |
| InChIKey | GSFUBCGLEXRAJW-ZETCQYMHSA-M |
| XLogP | 1.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.65 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |