C20H21ClO3 — CID 5108589
methyl 4-(4-chlorophenyl)-4-oxo-2-(4-propan-2-ylphenyl)butanoate (PubChem CID 5108589) has the molecular formula C20H21ClO3 and a molecular weight of 344.84 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-4-oxo-2-(4-propan-2-ylphenyl)butanoate.
| Compound Name | methyl 4-(4-chlorophenyl)-4-oxo-2-(4-propan-2-ylphenyl)butanoate |
|---|---|
| PubChem CID | 5108589 |
| Molecular Formula | C20H21ClO3 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-4-oxo-2-(4-propan-2-ylphenyl)butanoate |
| SMILES | COC(=O)C(CC(=O)c1ccc(Cl)cc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H21ClO3/c1-13(2)14-4-6-15(7-5-14)18(20(23)24-3)12-19(22)16-8-10-17(21)11-9-16/h4-11,13,18H,12H2,1-3H3 |
| InChIKey | RGPWQHRBJXQEEG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |