C17H21ClO4 — CID 161134849
methyl (2S,5S,6R)-2-(4-chlorophenyl)-5,6-dimethyl-4,7-dioxooctanoate (PubChem CID 161134849) has the molecular formula C17H21ClO4 and a molecular weight of 324.80 g/mol. Its IUPAC name is methyl (2S,5S,6R)-2-(4-chlorophenyl)-5,6-dimethyl-4,7-dioxooctanoate.
| Compound Name | methyl (2S,5S,6R)-2-(4-chlorophenyl)-5,6-dimethyl-4,7-dioxooctanoate |
|---|---|
| PubChem CID | 161134849 |
| Molecular Formula | C17H21ClO4 |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl (2S,5S,6R)-2-(4-chlorophenyl)-5,6-dimethyl-4,7-dioxooctanoate |
| SMILES | COC(=O)[C@@H](CC(=O)[C@@H](C)[C@@H](C)C(C)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClO4/c1-10(12(3)19)11(2)16(20)9-15(17(21)22-4)13-5-7-14(18)8-6-13/h5-8,10-11,15H,9H2,1-4H3/t10-,11+,15+/m1/s1 |
| InChIKey | UMQSDBCPAHSEIZ-ZETOZRRWSA-N |
| XLogP | 3.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |