C15H22ClNO3 — CID 158768943
methyl (2S,5R)-5-amino-6-methyl-4-oxo-2-phenylheptanoate;hydrochloride (PubChem CID 158768943) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is methyl (2S,5R)-5-amino-6-methyl-4-oxo-2-phenylheptanoate;hydrochloride.
| Compound Name | methyl (2S,5R)-5-amino-6-methyl-4-oxo-2-phenylheptanoate;hydrochloride |
|---|---|
| PubChem CID | 158768943 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl (2S,5R)-5-amino-6-methyl-4-oxo-2-phenylheptanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](CC(=O)[C@H](N)C(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-10(2)14(16)13(17)9-12(15(18)19-3)11-7-5-4-6-8-11;/h4-8,10,12,14H,9,16H2,1-3H3;1H/t12-,14+;/m0./s1 |
| InChIKey | YGOMHACCNGQXJG-DSHXVJGRSA-N |
| XLogP | 2.31 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |