methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate

C19H18O2 — CID 143108084

IUPACmethyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate
SMILESC=C(CC(C(=O)OC)c1ccccc1)C1=CC=C=CC=C1
InChIInChI=1S/C19H18O2/c1-15(16-10-6-3-4-7-11-16)14-18(19(20)21-2)17-12-8-5-9-13-17/h3,5-13,18H,1,14H2,2H3
InChIKeyLZWYOOYXKFMPSM-UHFFFAOYSA-N
MW278.35 g/mol
LogP4.10
Rot. Bonds5

About methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate

methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate (PubChem CID 143108084) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate.

Molecular Properties

Compound Namemethyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate
PubChem CID143108084
Molecular FormulaC19H18O2
Molecular Weight278.35 g/mol
Exact Mass278.13
IUPAC Namemethyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate
SMILESC=C(CC(C(=O)OC)c1ccccc1)C1=CC=C=CC=C1
InChIInChI=1S/C19H18O2/c1-15(16-10-6-3-4-7-11-16)14-18(19(20)21-2)17-12-8-5-9-13-17/h3,5-13,18H,1,14H2,2H3
InChIKeyLZWYOOYXKFMPSM-UHFFFAOYSA-N
XLogP4.10
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 54.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate?
The IUPAC name of methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate (CID 143108084) is methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate.
What is the SMILES notation for methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate?
The canonical SMILES for methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate is C=C(CC(C(=O)OC)c1ccccc1)C1=CC=C=CC=C1.
What is the InChIKey of methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate?
The InChIKey is LZWYOOYXKFMPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2/c1-15(16-10-6-3-4-7-11-16)14-18(19(20)21-2)17-12-8-5-9-13-17/h3,5-13,18H,1,14H2,2H3.
What are the key properties of methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate?
methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate has a molecular weight of 278.35 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyclohepta-1,3,4,6-tetraen-1-yl-2-phenylpent-4-enoate is sourced from PubChem (CID 143108084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).