methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate

C16H22O3 — CID 58340187

IUPACmethyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate
SMILESCOC(=O)[C@@H](CC(=O)[C@@H](C)c1ccccc1)C(C)C
InChIInChI=1S/C16H22O3/c1-11(2)14(16(18)19-4)10-15(17)12(3)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3/t12-,14-/m0/s1
InChIKeyPUMQLVBJYHOMJB-JSGCOSHPSA-N
MW262.35 g/mol
LogP3.19
Rot. Bonds6

About methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate

methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate (PubChem CID 58340187) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate.

Molecular Properties

Compound Namemethyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate
PubChem CID58340187
Molecular FormulaC16H22O3
Molecular Weight262.35 g/mol
Exact Mass262.16
IUPAC Namemethyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate
SMILESCOC(=O)[C@@H](CC(=O)[C@@H](C)c1ccccc1)C(C)C
InChIInChI=1S/C16H22O3/c1-11(2)14(16(18)19-4)10-15(17)12(3)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3/t12-,14-/m0/s1
InChIKeyPUMQLVBJYHOMJB-JSGCOSHPSA-N
XLogP3.19
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 53.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate?
The IUPAC name of methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate (CID 58340187) is methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate.
What is the SMILES notation for methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate?
The canonical SMILES for methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate is COC(=O)[C@@H](CC(=O)[C@@H](C)c1ccccc1)C(C)C.
What is the InChIKey of methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate?
The InChIKey is PUMQLVBJYHOMJB-JSGCOSHPSA-N. The full InChI is InChI=1S/C16H22O3/c1-11(2)14(16(18)19-4)10-15(17)12(3)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3/t12-,14-/m0/s1.
What are the key properties of methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate?
methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate has a molecular weight of 262.35 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,5S)-4-oxo-5-phenyl-2-propan-2-ylhexanoate is sourced from PubChem (CID 58340187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).