About bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid
bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid (PubChem CID 173440461) has the molecular formula C20H36N2O10
and a molecular weight of 464.51 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid.
Molecular Properties
| Compound Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid |
| PubChem CID | 173440461 |
| Molecular Formula | C20H36N2O10 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.OCCN(CCO)CCO.OCCN(CCO)CCO |
| InChI | InChI=1S/C8H6O4.2C6H15NO3/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10)(H,11,12);2*8-10H,1-6H2 |
| InChIKey | HPESPRHDEIQWOF-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 202.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid (CID 173440461) is bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid.
What is the SMILES notation for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The canonical SMILES for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid is O=C(O)c1ccc(C(=O)O)cc1.OCCN(CCO)CCO.OCCN(CCO)CCO.
What is the InChIKey of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The InChIKey is HPESPRHDEIQWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C6H15NO3/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10)(H,11,12);2*8-10H,1-6H2.
What are the key properties of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid has a molecular weight of 464.51 g/mol, XLogP of -2.39, 14 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid is sourced from PubChem (CID 173440461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).