bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid

C20H36N2O10 — CID 173440461

IUPACbis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)cc1.OCCN(CCO)CCO.OCCN(CCO)CCO
InChIInChI=1S/C8H6O4.2C6H15NO3/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10)(H,11,12);2*8-10H,1-6H2
InChIKeyHPESPRHDEIQWOF-UHFFFAOYSA-N
MW464.51 g/mol
LogP-2.39
Rot. Bonds14

About bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid

bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid (PubChem CID 173440461) has the molecular formula C20H36N2O10 and a molecular weight of 464.51 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid.

Molecular Properties

Compound Namebis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid
PubChem CID173440461
Molecular FormulaC20H36N2O10
Molecular Weight464.51 g/mol
Exact Mass464.24
IUPAC Namebis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)cc1.OCCN(CCO)CCO.OCCN(CCO)CCO
InChIInChI=1S/C8H6O4.2C6H15NO3/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10)(H,11,12);2*8-10H,1-6H2
InChIKeyHPESPRHDEIQWOF-UHFFFAOYSA-N
XLogP-2.39
TPSA202.46 Ų
H-Bond Donors8
H-Bond Acceptors10
Rotatable Bonds14
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500464.51
LogP ≤ 5-2.39
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 1010

Analyze bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid (CID 173440461) is bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid.
What is the SMILES notation for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The canonical SMILES for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid is O=C(O)c1ccc(C(=O)O)cc1.OCCN(CCO)CCO.OCCN(CCO)CCO.
What is the InChIKey of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
The InChIKey is HPESPRHDEIQWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C6H15NO3/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10)(H,11,12);2*8-10H,1-6H2.
What are the key properties of bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid?
bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid has a molecular weight of 464.51 g/mol, XLogP of -2.39, 14 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[bis(2-hydroxyethyl)amino]ethanol);terephthalic acid is sourced from PubChem (CID 173440461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).