C16H25ClN2O2 — CID 102994616
3-chloro-4-[3-(diethylamino)propyl-ethylamino]benzoic acid (PubChem CID 102994616) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 3-chloro-4-[3-(diethylamino)propyl-ethylamino]benzoic acid.
| Compound Name | 3-chloro-4-[3-(diethylamino)propyl-ethylamino]benzoic acid |
|---|---|
| PubChem CID | 102994616 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-chloro-4-[3-(diethylamino)propyl-ethylamino]benzoic acid |
| SMILES | CCN(CC)CCCN(CC)c1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O2/c1-4-18(5-2)10-7-11-19(6-3)15-9-8-13(16(20)21)12-14(15)17/h8-9,12H,4-7,10-11H2,1-3H3,(H,20,21) |
| InChIKey | YVSTZHSQVGSVMQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |