C12H14ClNO2 — CID 11310994
2-(4-chlorophenyl)-N,N-diethyl-2-oxoacetamide (PubChem CID 11310994) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-diethyl-2-oxoacetamide.
| Compound Name | 2-(4-chlorophenyl)-N,N-diethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 11310994 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-diethyl-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO2/c1-3-14(4-2)12(16)11(15)9-5-7-10(13)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | RRGJZZPRMWBRBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|