C21H21ClN2O2 — CID 5302284
2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N,N-diethyl-2-oxoacetamide (PubChem CID 5302284) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N,N-diethyl-2-oxoacetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N,N-diethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 5302284 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N,N-diethyl-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)C(=O)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H21ClN2O2/c1-3-23(4-2)21(26)20(25)18-14-24(19-8-6-5-7-17(18)19)13-15-9-11-16(22)12-10-15/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | GETDSLFXHGIVKB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|