C29H22ClN3O4 — CID 11455035
ethyl N-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetyl]-N-quinolin-6-ylcarbamate (PubChem CID 11455035) has the molecular formula C29H22ClN3O4 and a molecular weight of 511.97 g/mol. Its IUPAC name is ethyl N-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetyl]-N-quinolin-6-ylcarbamate.
| Compound Name | ethyl N-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetyl]-N-quinolin-6-ylcarbamate |
|---|---|
| PubChem CID | 11455035 |
| Molecular Formula | C29H22ClN3O4 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | ethyl N-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetyl]-N-quinolin-6-ylcarbamate |
| SMILES | CCOC(=O)N(C(=O)C(=O)c1cn(Cc2ccc(Cl)cc2)c2ccccc12)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C29H22ClN3O4/c1-2-37-29(36)33(22-13-14-25-20(16-22)6-5-15-31-25)28(35)27(34)24-18-32(26-8-4-3-7-23(24)26)17-19-9-11-21(30)12-10-19/h3-16,18H,2,17H2,1H3 |
| InChIKey | FPIPHMPAEQBYLF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|