C19H17Cl2NO — CID 3579948
1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]butan-1-one (PubChem CID 3579948) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]butan-1-one.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 3579948 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C19H17Cl2NO/c1-2-5-19(23)15-12-22(18-7-4-3-6-14(15)18)11-13-8-9-16(20)17(21)10-13/h3-4,6-10,12H,2,5,11H2,1H3 |
| InChIKey | IIXNDTWDOIZBTI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |