C17H13Cl2NO — CID 63490619
2-(3,4-dichlorophenyl)-1-(1-methylindol-3-yl)ethanone (PubChem CID 63490619) has the molecular formula C17H13Cl2NO and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(1-methylindol-3-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 63490619 |
| Molecular Formula | C17H13Cl2NO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(1-methylindol-3-yl)ethanone |
| SMILES | Cn1cc(C(=O)Cc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2NO/c1-20-10-13(12-4-2-3-5-16(12)20)17(21)9-11-6-7-14(18)15(19)8-11/h2-8,10H,9H2,1H3 |
| InChIKey | MQOISHGADXNOTD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |