C20H18N2O — CID 3392442
2-[(3-butanoylindol-1-yl)methyl]benzonitrile (PubChem CID 3392442) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[(3-butanoylindol-1-yl)methyl]benzonitrile.
| Compound Name | 2-[(3-butanoylindol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 3392442 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[(3-butanoylindol-1-yl)methyl]benzonitrile |
| SMILES | CCCC(=O)c1cn(Cc2ccccc2C#N)c2ccccc12 |
| InChI | InChI=1S/C20H18N2O/c1-2-7-20(23)18-14-22(19-11-6-5-10-17(18)19)13-16-9-4-3-8-15(16)12-21/h3-6,8-11,14H,2,7,13H2,1H3 |
| InChIKey | FJXHXXVNQHIIKA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |