C21H20Cl2N2O2 — CID 25031483
2-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-1-morpholin-4-ylethanone (PubChem CID 25031483) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 2-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 25031483 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(Cc1cn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c22-18-6-5-15(11-19(18)23)13-25-14-16(17-3-1-2-4-20(17)25)12-21(26)24-7-9-27-10-8-24/h1-6,11,14H,7-10,12-13H2 |
| InChIKey | PCRPRLYOULVIGI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |