C36H28Cl2N4O2S — CID 159566693
1-[(4-chlorophenyl)methyl]indole;2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide (PubChem CID 159566693) has the molecular formula C36H28Cl2N4O2S and a molecular weight of 651.62 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]indole;2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]indole;2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 159566693 |
| Molecular Formula | C36H28Cl2N4O2S |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]indole;2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3ccc(Cl)cc3)c3ccccc23)sn1.Clc1ccc(Cn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C21H16ClN3O2S.C15H12ClN/c1-13-10-19(28-24-13)23-21(27)20(26)17-12-25(18-5-3-2-4-16(17)18)11-14-6-8-15(22)9-7-14;16-14-7-5-12(6-8-14)11-17-10-9-13-3-1-2-4-15(13)17/h2-10,12H,11H2,1H3,(H,23,27);1-10H,11H2 |
| InChIKey | MHHCOKSMIVWTKO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|